C15H24Cl3N3O — CID 121230686
3-[[3-(ethylamino)propylamino]methyl]-1H-quinolin-4-one;trihydrochloride (PubChem CID 121230686) has the molecular formula C15H24Cl3N3O and a molecular weight of 368.74 g/mol. Its IUPAC name is 3-[[3-(ethylamino)propylamino]methyl]-1H-quinolin-4-one;trihydrochloride.
| Compound Name | 3-[[3-(ethylamino)propylamino]methyl]-1H-quinolin-4-one;trihydrochloride |
|---|---|
| PubChem CID | 121230686 |
| Molecular Formula | C15H24Cl3N3O |
| Molecular Weight | 368.74 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 3-[[3-(ethylamino)propylamino]methyl]-1H-quinolin-4-one;trihydrochloride |
| SMILES | CCNCCCNCc1c[nH]c2ccccc2c1=O.Cl.Cl.Cl |
| InChI | InChI=1S/C15H21N3O.3ClH/c1-2-16-8-5-9-17-10-12-11-18-14-7-4-3-6-13(14)15(12)19;;;/h3-4,6-7,11,16-17H,2,5,8-10H2,1H3,(H,18,19);3*1H |
| InChIKey | NVKOCTWDUSZGDK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.74 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|