C15H9NO7 — CID 121230902
5,7-dihydroxy-3-(4-hydroxyphenyl)-2-nitrochromen-4-one (PubChem CID 121230902) has the molecular formula C15H9NO7 and a molecular weight of 315.24 g/mol. Its IUPAC name is 5,7-dihydroxy-3-(4-hydroxyphenyl)-2-nitrochromen-4-one.
| Compound Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)-2-nitrochromen-4-one |
|---|---|
| PubChem CID | 121230902 |
| Molecular Formula | C15H9NO7 |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)-2-nitrochromen-4-one |
| SMILES | O=c1c(-c2ccc(O)cc2)c([N+](=O)[O-])oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H9NO7/c17-8-3-1-7(2-4-8)12-14(20)13-10(19)5-9(18)6-11(13)23-15(12)16(21)22/h1-6,17-19H |
| InChIKey | XWKQYZWOKXSJOA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|