C10H5F6NO2 — CID 121234688
2-[3,4-bis(trifluoromethoxy)phenyl]acetonitrile (PubChem CID 121234688) has the molecular formula C10H5F6NO2 and a molecular weight of 285.14 g/mol. Its IUPAC name is 2-[3,4-bis(trifluoromethoxy)phenyl]acetonitrile.
| Compound Name | 2-[3,4-bis(trifluoromethoxy)phenyl]acetonitrile |
|---|---|
| PubChem CID | 121234688 |
| Molecular Formula | C10H5F6NO2 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 2-[3,4-bis(trifluoromethoxy)phenyl]acetonitrile |
| SMILES | N#CCc1ccc(OC(F)(F)F)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C10H5F6NO2/c11-9(12,13)18-7-2-1-6(3-4-17)5-8(7)19-10(14,15)16/h1-2,5H,3H2 |
| InChIKey | WSPNIFABXYMBGG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |