C15H27BNO2 — CID 121235088
CID 121235088 (PubChem CID 121235088) has the molecular formula C15H27BNO2 and a molecular weight of 264.20 g/mol.
| Compound Name | CID 121235088 |
|---|---|
| PubChem CID | 121235088 |
| Molecular Formula | C15H27BNO2 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | — |
| SMILES | CC(C)C[C@H](N)[B][C@@H]1O[C@@H]2[C@@H](C[C@H]3C[C@@H]2C3(C)C)O1 |
| InChI | InChI=1S/C15H27BNO2/c1-8(2)5-12(17)16-14-18-11-7-9-6-10(13(11)19-14)15(9,3)4/h8-14H,5-7,17H2,1-4H3/t9-,10+,11-,12+,13+,14+/m1/s1 |
| InChIKey | HEKDSWQCHLINPS-QUGYJXMDSA-N |
| XLogP | 2.16 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|