About 1-ethylpyridin-2-imine;hydroiodide
1-ethylpyridin-2-imine;hydroiodide (PubChem CID 121235171) has the molecular formula C7H11IN2
and a molecular weight of 250.08 g/mol. Its IUPAC name is 1-ethylpyridin-2-imine;hydroiodide.
Molecular Properties
| Compound Name | 1-ethylpyridin-2-imine;hydroiodide |
| PubChem CID | 121235171 |
| Molecular Formula | C7H11IN2 |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 1-ethylpyridin-2-imine;hydroiodide |
| SMILES | I.[H]/N=c1\ccccn1CC |
| InChI | InChI=1S/C7H10N2.HI/c1-2-9-6-4-3-5-7(9)8;/h3-6,8H,2H2,1H3;1H/b8-7+; |
| InChIKey | YLIIAGSCEFSVEM-USRGLUTNSA-N |
| XLogP | 1.61 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylpyridin-2-imine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpyridin-2-imine;hydroiodide?
The IUPAC name of 1-ethylpyridin-2-imine;hydroiodide (CID 121235171) is 1-ethylpyridin-2-imine;hydroiodide.
What is the SMILES notation for 1-ethylpyridin-2-imine;hydroiodide?
The canonical SMILES for 1-ethylpyridin-2-imine;hydroiodide is I.[H]/N=c1\ccccn1CC.
What is the InChIKey of 1-ethylpyridin-2-imine;hydroiodide?
The InChIKey is YLIIAGSCEFSVEM-USRGLUTNSA-N. The full InChI is InChI=1S/C7H10N2.HI/c1-2-9-6-4-3-5-7(9)8;/h3-6,8H,2H2,1H3;1H/b8-7+;.
What are the key properties of 1-ethylpyridin-2-imine;hydroiodide?
1-ethylpyridin-2-imine;hydroiodide has a molecular weight of 250.08 g/mol, XLogP of 1.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpyridin-2-imine;hydroiodide is sourced from PubChem (CID 121235171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).