C31H32N4O3S — CID 121238218
4-[2-(1H-indol-3-yl)ethyl]-3-methyl-N-(4-morpholin-4-ylphenyl)-5-oxo-2H-1,4-benzothiazepine-3-carboxamide (PubChem CID 121238218) has the molecular formula C31H32N4O3S and a molecular weight of 540.69 g/mol. Its IUPAC name is 4-[2-(1H-indol-3-yl)ethyl]-3-methyl-N-(4-morpholin-4-ylphenyl)-5-oxo-2H-1,4-benzothiazepine-3-carboxamide.
| Compound Name | 4-[2-(1H-indol-3-yl)ethyl]-3-methyl-N-(4-morpholin-4-ylphenyl)-5-oxo-2H-1,4-benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 121238218 |
| Molecular Formula | C31H32N4O3S |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 4-[2-(1H-indol-3-yl)ethyl]-3-methyl-N-(4-morpholin-4-ylphenyl)-5-oxo-2H-1,4-benzothiazepine-3-carboxamide |
| SMILES | CC1(C(=O)Nc2ccc(N3CCOCC3)cc2)CSc2ccccc2C(=O)N1CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C31H32N4O3S/c1-31(30(37)33-23-10-12-24(13-11-23)34-16-18-38-19-17-34)21-39-28-9-5-3-7-26(28)29(36)35(31)15-14-22-20-32-27-8-4-2-6-25(22)27/h2-13,20,32H,14-19,21H2,1H3,(H,33,37) |
| InChIKey | CUVOBMWGMXCOGX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|