C28H36N4O4S — CID 4177508
3-methyl-N-(4-morpholin-4-ylphenyl)-4-(3-morpholin-4-ylpropyl)-5-oxo-2H-1,4-benzothiazepine-3-carboxamide (PubChem CID 4177508) has the molecular formula C28H36N4O4S and a molecular weight of 524.69 g/mol. Its IUPAC name is 3-methyl-N-(4-morpholin-4-ylphenyl)-4-(3-morpholin-4-ylpropyl)-5-oxo-2H-1,4-benzothiazepine-3-carboxamide.
| Compound Name | 3-methyl-N-(4-morpholin-4-ylphenyl)-4-(3-morpholin-4-ylpropyl)-5-oxo-2H-1,4-benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 4177508 |
| Molecular Formula | C28H36N4O4S |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 3-methyl-N-(4-morpholin-4-ylphenyl)-4-(3-morpholin-4-ylpropyl)-5-oxo-2H-1,4-benzothiazepine-3-carboxamide |
| SMILES | CC1(C(=O)Nc2ccc(N3CCOCC3)cc2)CSc2ccccc2C(=O)N1CCCN1CCOCC1 |
| InChI | InChI=1S/C28H36N4O4S/c1-28(27(34)29-22-7-9-23(10-8-22)31-15-19-36-20-16-31)21-37-25-6-3-2-5-24(25)26(33)32(28)12-4-11-30-13-17-35-18-14-30/h2-3,5-10H,4,11-21H2,1H3,(H,29,34) |
| InChIKey | XYALUVKIGFLNCY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|