C31H42N6O2S — CID 20605927
N-(4-morpholin-4-ylphenyl)-4-[2-oxo-3-(3-piperidin-1-ylpropyl)benzimidazol-1-yl]piperidine-1-carbothioamide (PubChem CID 20605927) has the molecular formula C31H42N6O2S and a molecular weight of 562.78 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-4-[2-oxo-3-(3-piperidin-1-ylpropyl)benzimidazol-1-yl]piperidine-1-carbothioamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-4-[2-oxo-3-(3-piperidin-1-ylpropyl)benzimidazol-1-yl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 20605927 |
| Molecular Formula | C31H42N6O2S |
| Molecular Weight | 562.78 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-4-[2-oxo-3-(3-piperidin-1-ylpropyl)benzimidazol-1-yl]piperidine-1-carbothioamide |
| SMILES | O=c1n(CCCN2CCCCC2)c2ccccc2n1C1CCN(C(=S)Nc2ccc(N3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C31H42N6O2S/c38-31-36(18-6-17-33-15-4-1-5-16-33)28-7-2-3-8-29(28)37(31)27-13-19-35(20-14-27)30(40)32-25-9-11-26(12-10-25)34-21-23-39-24-22-34/h2-3,7-12,27H,1,4-6,13-24H2,(H,32,40) |
| InChIKey | WHFWSRFDSAOZDS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 57.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.78 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|