C24H38N4O — CID 21186512
1-[1-(cyclooctylmethyl)piperidin-4-yl]-3-[2-(methylamino)ethyl]benzimidazol-2-one (PubChem CID 21186512) has the molecular formula C24H38N4O and a molecular weight of 398.60 g/mol. Its IUPAC name is 1-[1-(cyclooctylmethyl)piperidin-4-yl]-3-[2-(methylamino)ethyl]benzimidazol-2-one.
| Compound Name | 1-[1-(cyclooctylmethyl)piperidin-4-yl]-3-[2-(methylamino)ethyl]benzimidazol-2-one |
|---|---|
| PubChem CID | 21186512 |
| Molecular Formula | C24H38N4O |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | 1-[1-(cyclooctylmethyl)piperidin-4-yl]-3-[2-(methylamino)ethyl]benzimidazol-2-one |
| SMILES | CNCCn1c(=O)n(C2CCN(CC3CCCCCCC3)CC2)c2ccccc21 |
| InChI | InChI=1S/C24H38N4O/c1-25-15-18-27-22-11-7-8-12-23(22)28(24(27)29)21-13-16-26(17-14-21)19-20-9-5-3-2-4-6-10-20/h7-8,11-12,20-21,25H,2-6,9-10,13-19H2,1H3 |
| InChIKey | HBERIDWULUQDQC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 42.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |