C26H42N4O — CID 21186476
1-[1-(cyclooctylmethyl)-3-[(dimethylamino)methyl]piperidin-4-yl]-3-ethylbenzimidazol-2-one (PubChem CID 21186476) has the molecular formula C26H42N4O and a molecular weight of 426.65 g/mol. Its IUPAC name is 1-[1-(cyclooctylmethyl)-3-[(dimethylamino)methyl]piperidin-4-yl]-3-ethylbenzimidazol-2-one.
| Compound Name | 1-[1-(cyclooctylmethyl)-3-[(dimethylamino)methyl]piperidin-4-yl]-3-ethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 21186476 |
| Molecular Formula | C26H42N4O |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.34 |
| IUPAC Name | 1-[1-(cyclooctylmethyl)-3-[(dimethylamino)methyl]piperidin-4-yl]-3-ethylbenzimidazol-2-one |
| SMILES | CCn1c(=O)n(C2CCN(CC3CCCCCCC3)CC2CN(C)C)c2ccccc21 |
| InChI | InChI=1S/C26H42N4O/c1-4-29-24-14-10-11-15-25(24)30(26(29)31)23-16-17-28(20-22(23)19-27(2)3)18-21-12-8-6-5-7-9-13-21/h10-11,14-15,21-23H,4-9,12-13,16-20H2,1-3H3 |
| InChIKey | QNFMFRDWRWKNDA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 33.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |