C21H31N3O2 — CID 21186441
1-[1-(cyclooctylmethyl)piperidin-4-yl]-3-hydroxybenzimidazol-2-one (PubChem CID 21186441) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-[1-(cyclooctylmethyl)piperidin-4-yl]-3-hydroxybenzimidazol-2-one.
| Compound Name | 1-[1-(cyclooctylmethyl)piperidin-4-yl]-3-hydroxybenzimidazol-2-one |
|---|---|
| PubChem CID | 21186441 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 1-[1-(cyclooctylmethyl)piperidin-4-yl]-3-hydroxybenzimidazol-2-one |
| SMILES | O=c1n(O)c2ccccc2n1C1CCN(CC2CCCCCCC2)CC1 |
| InChI | InChI=1S/C21H31N3O2/c25-21-23(19-10-6-7-11-20(19)24(21)26)18-12-14-22(15-13-18)16-17-8-4-2-1-3-5-9-17/h6-7,10-11,17-18,26H,1-5,8-9,12-16H2 |
| InChIKey | LAZUJTWVIKSIDX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|