C25H37N3O — CID 21186450
1-[1-(cyclooctylmethyl)-3-ethenylpiperidin-4-yl]-3-ethylbenzimidazol-2-one (PubChem CID 21186450) has the molecular formula C25H37N3O and a molecular weight of 395.59 g/mol. Its IUPAC name is 1-[1-(cyclooctylmethyl)-3-ethenylpiperidin-4-yl]-3-ethylbenzimidazol-2-one.
| Compound Name | 1-[1-(cyclooctylmethyl)-3-ethenylpiperidin-4-yl]-3-ethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 21186450 |
| Molecular Formula | C25H37N3O |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.29 |
| IUPAC Name | 1-[1-(cyclooctylmethyl)-3-ethenylpiperidin-4-yl]-3-ethylbenzimidazol-2-one |
| SMILES | C=CC1CN(CC2CCCCCCC2)CCC1n1c(=O)n(CC)c2ccccc21 |
| InChI | InChI=1S/C25H37N3O/c1-3-21-19-26(18-20-12-8-6-5-7-9-13-20)17-16-22(21)28-24-15-11-10-14-23(24)27(4-2)25(28)29/h3,10-11,14-15,20-22H,1,4-9,12-13,16-19H2,2H3 |
| InChIKey | UBYHNJXEFIHHIO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 30.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|