C20H14Cl2N4O2 — CID 121238353
[3,5-bis(4-chloroanilino)pyrazol-1-yl]-(furan-2-yl)methanone (PubChem CID 121238353) has the molecular formula C20H14Cl2N4O2 and a molecular weight of 413.26 g/mol. Its IUPAC name is [3,5-bis(4-chloroanilino)pyrazol-1-yl]-(furan-2-yl)methanone.
| Compound Name | [3,5-bis(4-chloroanilino)pyrazol-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 121238353 |
| Molecular Formula | C20H14Cl2N4O2 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | [3,5-bis(4-chloroanilino)pyrazol-1-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)n1nc(Nc2ccc(Cl)cc2)cc1Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H14Cl2N4O2/c21-13-3-7-15(8-4-13)23-18-12-19(24-16-9-5-14(22)6-10-16)26(25-18)20(27)17-2-1-11-28-17/h1-12,24H,(H,23,25) |
| InChIKey | OXIHWEWJKYNYCT-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 72.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |