C14H18N2O6 — CID 121245335
butyl 2-[(4-hydroxy-2-oxo-5,7-dihydro-1H-furo[3,4-b]pyridine-3-carbonyl)amino]acetate (PubChem CID 121245335) has the molecular formula C14H18N2O6 and a molecular weight of 310.31 g/mol. Its IUPAC name is butyl 2-[(4-hydroxy-2-oxo-5,7-dihydro-1H-furo[3,4-b]pyridine-3-carbonyl)amino]acetate.
| Compound Name | butyl 2-[(4-hydroxy-2-oxo-5,7-dihydro-1H-furo[3,4-b]pyridine-3-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 121245335 |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | butyl 2-[(4-hydroxy-2-oxo-5,7-dihydro-1H-furo[3,4-b]pyridine-3-carbonyl)amino]acetate |
| SMILES | CCCCOC(=O)CNC(=O)c1c(O)c2c([nH]c1=O)COC2 |
| InChI | InChI=1S/C14H18N2O6/c1-2-3-4-22-10(17)5-15-13(19)11-12(18)8-6-21-7-9(8)16-14(11)20/h2-7H2,1H3,(H,15,19)(H2,16,18,20) |
| InChIKey | ROFQYXMTQZGZAF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|