C18H24N2O6 — CID 23257088
butyl (2E)-2-[(8E)-8-(2-butoxy-2-oxoethylidene)-3,6-dioxo-2,5-diazabicyclo[2.2.2]octan-7-ylidene]acetate (PubChem CID 23257088) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is butyl (2E)-2-[(8E)-8-(2-butoxy-2-oxoethylidene)-3,6-dioxo-2,5-diazabicyclo[2.2.2]octan-7-ylidene]acetate.
| Compound Name | butyl (2E)-2-[(8E)-8-(2-butoxy-2-oxoethylidene)-3,6-dioxo-2,5-diazabicyclo[2.2.2]octan-7-ylidene]acetate |
|---|---|
| PubChem CID | 23257088 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | butyl (2E)-2-[(8E)-8-(2-butoxy-2-oxoethylidene)-3,6-dioxo-2,5-diazabicyclo[2.2.2]octan-7-ylidene]acetate |
| SMILES | CCCCOC(=O)/C=C1C(=C/C(=O)OCCCC)\C2NC(=O)C\1NC2=O |
| InChI | InChI=1S/C18H24N2O6/c1-3-5-7-25-13(21)9-11-12(10-14(22)26-8-6-4-2)16-18(24)19-15(11)17(23)20-16/h9-10,15-16H,3-8H2,1-2H3,(H,19,24)(H,20,23)/b11-9+,12-10+ |
| InChIKey | YEGRORSIQHFIOL-WGDLNXRISA-N |
| XLogP | 0.52 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|