About 10-[4-[2-[3,6-bis(ethenyl)carbazol-9-yl]-4-pyridinyl]-2-pyridinyl]phenoxazine
10-[4-[2-[3,6-bis(ethenyl)carbazol-9-yl]-4-pyridinyl]-2-pyridinyl]phenoxazine (PubChem CID 121245590) has the molecular formula C38H26N4O
and a molecular weight of 554.65 g/mol. Its IUPAC name is 10-[4-[2-[3,6-bis(ethenyl)carbazol-9-yl]-4-pyridinyl]-2-pyridinyl]phenoxazine.
Molecular Properties
| Compound Name | 10-[4-[2-[3,6-bis(ethenyl)carbazol-9-yl]-4-pyridinyl]-2-pyridinyl]phenoxazine |
| PubChem CID | 121245590 |
| Molecular Formula | C38H26N4O |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | 10-[4-[2-[3,6-bis(ethenyl)carbazol-9-yl]-4-pyridinyl]-2-pyridinyl]phenoxazine |
| SMILES | C=Cc1ccc2c(c1)c1cc(C=C)ccc1n2-c1cc(-c2ccnc(N3c4ccccc4Oc4ccccc43)c2)ccn1 |
| InChI | InChI=1S/C38H26N4O/c1-3-25-13-15-31-29(21-25)30-22-26(4-2)14-16-32(30)41(31)37-23-27(17-19-39-37)28-18-20-40-38(24-28)42-33-9-5-7-11-35(33)43-36-12-8-6-10-34(36)42/h3-24H,1-2H2 |
| InChIKey | USDOCXCHPZIKBD-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 10-[4-[2-[3,6-bis(ethenyl)carbazol-9-yl]-4-pyridinyl]-2-pyridinyl]phenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[4-[2-[3,6-bis(ethenyl)carbazol-9-yl]-4-pyridinyl]-2-pyridinyl]phenoxazine?
The IUPAC name of 10-[4-[2-[3,6-bis(ethenyl)carbazol-9-yl]-4-pyridinyl]-2-pyridinyl]phenoxazine (CID 121245590) is 10-[4-[2-[3,6-bis(ethenyl)carbazol-9-yl]-4-pyridinyl]-2-pyridinyl]phenoxazine.
What is the SMILES notation for 10-[4-[2-[3,6-bis(ethenyl)carbazol-9-yl]-4-pyridinyl]-2-pyridinyl]phenoxazine?
The canonical SMILES for 10-[4-[2-[3,6-bis(ethenyl)carbazol-9-yl]-4-pyridinyl]-2-pyridinyl]phenoxazine is C=Cc1ccc2c(c1)c1cc(C=C)ccc1n2-c1cc(-c2ccnc(N3c4ccccc4Oc4ccccc43)c2)ccn1.
What is the InChIKey of 10-[4-[2-[3,6-bis(ethenyl)carbazol-9-yl]-4-pyridinyl]-2-pyridinyl]phenoxazine?
The InChIKey is USDOCXCHPZIKBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H26N4O/c1-3-25-13-15-31-29(21-25)30-22-26(4-2)14-16-32(30)41(31)37-23-27(17-19-39-37)28-18-20-40-38(24-28)42-33-9-5-7-11-35(33)43-36-12-8-6-10-34(36)42/h3-24H,1-2H2.
What are the key properties of 10-[4-[2-[3,6-bis(ethenyl)carbazol-9-yl]-4-pyridinyl]-2-pyridinyl]phenoxazine?
10-[4-[2-[3,6-bis(ethenyl)carbazol-9-yl]-4-pyridinyl]-2-pyridinyl]phenoxazine has a molecular weight of 554.65 g/mol, XLogP of 10.10, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[4-[2-[3,6-bis(ethenyl)carbazol-9-yl]-4-pyridinyl]-2-pyridinyl]phenoxazine is sourced from PubChem (CID 121245590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).