C62H122N2 — CID 121245733
9-N,9-N,26-N,26-N-tetramethyl-16-[(1S,2R)-2-octylcyclopropyl]-35-[(1S,2S)-2-[[(1R,2R)-2-pentylcyclopropyl]methyl]cyclopropyl]pentatriacontane-9,26-diamine (PubChem CID 121245733) has the molecular formula C62H122N2 and a molecular weight of 895.67 g/mol. Its IUPAC name is 9-N,9-N,26-N,26-N-tetramethyl-16-[(1S,2R)-2-octylcyclopropyl]-35-[(1S,2S)-2-[[(1R,2R)-2-pentylcyclopropyl]methyl]cyclopropyl]pentatriacontane-9,26-diamine.
| Compound Name | 9-N,9-N,26-N,26-N-tetramethyl-16-[(1S,2R)-2-octylcyclopropyl]-35-[(1S,2S)-2-[[(1R,2R)-2-pentylcyclopropyl]methyl]cyclopropyl]pentatriacontane-9,26-diamine |
|---|---|
| PubChem CID | 121245733 |
| Molecular Formula | C62H122N2 |
| Molecular Weight | 895.67 g/mol |
| Exact Mass | 894.96 |
| IUPAC Name | 9-N,9-N,26-N,26-N-tetramethyl-16-[(1S,2R)-2-octylcyclopropyl]-35-[(1S,2S)-2-[[(1R,2R)-2-pentylcyclopropyl]methyl]cyclopropyl]pentatriacontane-9,26-diamine |
| SMILES | CCCCCCCCC(CCCCCCC(CCCCCCCCCC(CCCCCCCCC[C@H]1C[C@H]1C[C@H]1C[C@H]1CCCCC)N(C)C)[C@H]1C[C@H]1CCCCCCCC)N(C)C |
| InChI | InChI=1S/C62H122N2/c1-8-11-14-16-24-36-45-57-53-62(57)54(42-34-30-31-40-49-61(64(6)7)46-37-27-17-15-12-9-2)41-33-25-20-18-22-28-38-47-60(63(4)5)48-39-29-23-19-21-26-35-44-56-51-59(56)52-58-50-55(58)43-32-13-10-3/h54-62H,8-53H2,1-7H3/t54?,55-,56+,57-,58-,59+,60?,61?,62-/m1/s1 |
| InChIKey | IQHUKQIEUQCAKT-LDZYSAQQSA-N |
| XLogP | 20.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.67 |
| LogP ≤ 5 | 20.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|