C28H55N — CID 142721086
1-[(1S,2S)-2-(cyclopropylmethyl)cyclopropyl]-N,N-dimethylnonadecan-10-amine (PubChem CID 142721086) has the molecular formula C28H55N and a molecular weight of 405.76 g/mol. Its IUPAC name is 1-[(1S,2S)-2-(cyclopropylmethyl)cyclopropyl]-N,N-dimethylnonadecan-10-amine.
| Compound Name | 1-[(1S,2S)-2-(cyclopropylmethyl)cyclopropyl]-N,N-dimethylnonadecan-10-amine |
|---|---|
| PubChem CID | 142721086 |
| Molecular Formula | C28H55N |
| Molecular Weight | 405.76 g/mol |
| Exact Mass | 405.43 |
| IUPAC Name | 1-[(1S,2S)-2-(cyclopropylmethyl)cyclopropyl]-N,N-dimethylnonadecan-10-amine |
| SMILES | CCCCCCCCCC(CCCCCCCCC[C@H]1C[C@H]1CC1CC1)N(C)C |
| InChI | InChI=1S/C28H55N/c1-4-5-6-7-9-13-16-19-28(29(2)3)20-17-14-11-8-10-12-15-18-26-24-27(26)23-25-21-22-25/h25-28H,4-24H2,1-3H3/t26-,27+,28?/m0/s1 |
| InChIKey | RNYWRMAYYQUPAS-MDEZFMAYSA-N |
| XLogP | 9.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.76 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|