C28H57N — CID 126566336
(8S)-N,N-dimethyl-1-[(2R)-2-octylcyclopropyl]pentadecan-8-amine (PubChem CID 126566336) has the molecular formula C28H57N and a molecular weight of 407.77 g/mol. Its IUPAC name is (8S)-N,N-dimethyl-1-[(2R)-2-octylcyclopropyl]pentadecan-8-amine.
| Compound Name | (8S)-N,N-dimethyl-1-[(2R)-2-octylcyclopropyl]pentadecan-8-amine |
|---|---|
| PubChem CID | 126566336 |
| Molecular Formula | C28H57N |
| Molecular Weight | 407.77 g/mol |
| Exact Mass | 407.45 |
| IUPAC Name | (8S)-N,N-dimethyl-1-[(2R)-2-octylcyclopropyl]pentadecan-8-amine |
| SMILES | CCCCCCCC[C@@H]1CC1CCCCCCC[C@H](CCCCCCC)N(C)C |
| InChI | InChI=1S/C28H57N/c1-5-7-9-11-14-17-21-26-25-27(26)22-18-15-12-16-20-24-28(29(3)4)23-19-13-10-8-6-2/h26-28H,5-25H2,1-4H3/t26-,27?,28+/m1/s1 |
| InChIKey | NHKQLBKUKIHXPD-UNQNHFTRSA-N |
| XLogP | 9.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.77 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|