C18H16N4O — CID 121248088
(2S,3S)-1-cyano-N-(6-ethynylisoquinolin-3-yl)-2-methylpyrrolidine-3-carboxamide (PubChem CID 121248088) has the molecular formula C18H16N4O and a molecular weight of 304.35 g/mol. Its IUPAC name is (2S,3S)-1-cyano-N-(6-ethynylisoquinolin-3-yl)-2-methylpyrrolidine-3-carboxamide.
| Compound Name | (2S,3S)-1-cyano-N-(6-ethynylisoquinolin-3-yl)-2-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 121248088 |
| Molecular Formula | C18H16N4O |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (2S,3S)-1-cyano-N-(6-ethynylisoquinolin-3-yl)-2-methylpyrrolidine-3-carboxamide |
| SMILES | C#Cc1ccc2cnc(NC(=O)[C@H]3CCN(C#N)[C@H]3C)cc2c1 |
| InChI | InChI=1S/C18H16N4O/c1-3-13-4-5-14-10-20-17(9-15(14)8-13)21-18(23)16-6-7-22(11-19)12(16)2/h1,4-5,8-10,12,16H,6-7H2,2H3,(H,20,21,23)/t12-,16-/m0/s1 |
| InChIKey | VKZXJUBADCMWAN-LRDDRELGSA-N |
| XLogP | 2.35 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|