C15H16ClF2N3O2 — CID 121249435
2-chloro-4-[1-(2,2-difluoroethyl)-3-(oxan-4-yl)pyrazol-4-yl]oxypyridine (PubChem CID 121249435) has the molecular formula C15H16ClF2N3O2 and a molecular weight of 343.76 g/mol. Its IUPAC name is 2-chloro-4-[1-(2,2-difluoroethyl)-3-(oxan-4-yl)pyrazol-4-yl]oxypyridine.
| Compound Name | 2-chloro-4-[1-(2,2-difluoroethyl)-3-(oxan-4-yl)pyrazol-4-yl]oxypyridine |
|---|---|
| PubChem CID | 121249435 |
| Molecular Formula | C15H16ClF2N3O2 |
| Molecular Weight | 343.76 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 2-chloro-4-[1-(2,2-difluoroethyl)-3-(oxan-4-yl)pyrazol-4-yl]oxypyridine |
| SMILES | FC(F)Cn1cc(Oc2ccnc(Cl)c2)c(C2CCOCC2)n1 |
| InChI | InChI=1S/C15H16ClF2N3O2/c16-13-7-11(1-4-19-13)23-12-8-21(9-14(17)18)20-15(12)10-2-5-22-6-3-10/h1,4,7-8,10,14H,2-3,5-6,9H2 |
| InChIKey | KHGMCLQHYQKLJC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.76 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|