C15H14ClF2N3O — CID 150825451
2-chloro-4-[1-cyclopropyl-3-(3,3-difluorocyclobutyl)pyrazol-4-yl]oxypyridine (PubChem CID 150825451) has the molecular formula C15H14ClF2N3O and a molecular weight of 325.75 g/mol. Its IUPAC name is 2-chloro-4-[1-cyclopropyl-3-(3,3-difluorocyclobutyl)pyrazol-4-yl]oxypyridine.
| Compound Name | 2-chloro-4-[1-cyclopropyl-3-(3,3-difluorocyclobutyl)pyrazol-4-yl]oxypyridine |
|---|---|
| PubChem CID | 150825451 |
| Molecular Formula | C15H14ClF2N3O |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 2-chloro-4-[1-cyclopropyl-3-(3,3-difluorocyclobutyl)pyrazol-4-yl]oxypyridine |
| SMILES | FC1(F)CC(c2nn(C3CC3)cc2Oc2ccnc(Cl)c2)C1 |
| InChI | InChI=1S/C15H14ClF2N3O/c16-13-5-11(3-4-19-13)22-12-8-21(10-1-2-10)20-14(12)9-6-15(17,18)7-9/h3-5,8-10H,1-2,6-7H2 |
| InChIKey | KKVDEACBWVZZIG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|