C18H22ClN3O2 — CID 155765610
2-chloro-4-[3-cyclopropyl-1-[(2S,6R)-2,6-dimethyloxan-4-yl]pyrazol-5-yl]oxypyridine (PubChem CID 155765610) has the molecular formula C18H22ClN3O2 and a molecular weight of 347.85 g/mol. Its IUPAC name is 2-chloro-4-[3-cyclopropyl-1-[(2S,6R)-2,6-dimethyloxan-4-yl]pyrazol-5-yl]oxypyridine.
| Compound Name | 2-chloro-4-[3-cyclopropyl-1-[(2S,6R)-2,6-dimethyloxan-4-yl]pyrazol-5-yl]oxypyridine |
|---|---|
| PubChem CID | 155765610 |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 2-chloro-4-[3-cyclopropyl-1-[(2S,6R)-2,6-dimethyloxan-4-yl]pyrazol-5-yl]oxypyridine |
| SMILES | C[C@@H]1CC(n2nc(C3CC3)cc2Oc2ccnc(Cl)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C18H22ClN3O2/c1-11-7-14(8-12(2)23-11)22-18(10-16(21-22)13-3-4-13)24-15-5-6-20-17(19)9-15/h5-6,9-14H,3-4,7-8H2,1-2H3/t11-,12+,14? |
| InChIKey | JFSLIFHNUZDCJQ-ONXXMXGDSA-N |
| XLogP | 4.73 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|