C17H19ClN2O2 — CID 154963843
5-[(2-chloro-4-pyridinyl)oxy]-2,3-dimethyl-6-(oxan-4-yl)pyridine (PubChem CID 154963843) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 5-[(2-chloro-4-pyridinyl)oxy]-2,3-dimethyl-6-(oxan-4-yl)pyridine.
| Compound Name | 5-[(2-chloro-4-pyridinyl)oxy]-2,3-dimethyl-6-(oxan-4-yl)pyridine |
|---|---|
| PubChem CID | 154963843 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 5-[(2-chloro-4-pyridinyl)oxy]-2,3-dimethyl-6-(oxan-4-yl)pyridine |
| SMILES | Cc1cc(Oc2ccnc(Cl)c2)c(C2CCOCC2)nc1C |
| InChI | InChI=1S/C17H19ClN2O2/c1-11-9-15(22-14-3-6-19-16(18)10-14)17(20-12(11)2)13-4-7-21-8-5-13/h3,6,9-10,13H,4-5,7-8H2,1-2H3 |
| InChIKey | VYMZJNARUWVPHB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|