C20H28Cl2N4O2 — CID 158747861
2-chloro-4-methylpyridine;2-(oxan-4-yl)-3-piperidin-4-yloxypyrazine;hydrochloride (PubChem CID 158747861) has the molecular formula C20H28Cl2N4O2 and a molecular weight of 427.38 g/mol. Its IUPAC name is 2-chloro-4-methylpyridine;2-(oxan-4-yl)-3-piperidin-4-yloxypyrazine;hydrochloride.
| Compound Name | 2-chloro-4-methylpyridine;2-(oxan-4-yl)-3-piperidin-4-yloxypyrazine;hydrochloride |
|---|---|
| PubChem CID | 158747861 |
| Molecular Formula | C20H28Cl2N4O2 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 2-chloro-4-methylpyridine;2-(oxan-4-yl)-3-piperidin-4-yloxypyrazine;hydrochloride |
| SMILES | Cc1ccnc(Cl)c1.Cl.c1cnc(C2CCOCC2)c(OC2CCNCC2)n1 |
| InChI | InChI=1S/C14H21N3O2.C6H6ClN.ClH/c1-5-15-6-2-12(1)19-14-13(16-7-8-17-14)11-3-9-18-10-4-11;1-5-2-3-8-6(7)4-5;/h7-8,11-12,15H,1-6,9-10H2;2-4H,1H3;1H |
| InChIKey | RJFBZEULSYESRE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|