C25H31Cl2N3O2 — CID 158280503
2-chloro-8-methylquinoline;3-(oxan-4-yl)-2-piperidin-4-yloxypyridine;hydrochloride (PubChem CID 158280503) has the molecular formula C25H31Cl2N3O2 and a molecular weight of 476.45 g/mol. Its IUPAC name is 2-chloro-8-methylquinoline;3-(oxan-4-yl)-2-piperidin-4-yloxypyridine;hydrochloride.
| Compound Name | 2-chloro-8-methylquinoline;3-(oxan-4-yl)-2-piperidin-4-yloxypyridine;hydrochloride |
|---|---|
| PubChem CID | 158280503 |
| Molecular Formula | C25H31Cl2N3O2 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 2-chloro-8-methylquinoline;3-(oxan-4-yl)-2-piperidin-4-yloxypyridine;hydrochloride |
| SMILES | Cc1cccc2ccc(Cl)nc12.Cl.c1cnc(OC2CCNCC2)c(C2CCOCC2)c1 |
| InChI | InChI=1S/C15H22N2O2.C10H8ClN.ClH/c1-2-14(12-5-10-18-11-6-12)15(17-7-1)19-13-3-8-16-9-4-13;1-7-3-2-4-8-5-6-9(11)12-10(7)8;/h1-2,7,12-13,16H,3-6,8-11H2;2-6H,1H3;1H |
| InChIKey | KQZQKNOBYPHBHX-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|