C33H46N3O7PS2 — CID 121254944
[(2S)-1-[(2S,3aS,7aS)-2-[[(1R)-1-bis(4-methylsulfanylphenoxy)phosphorylbutyl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-methyl-1-oxobutan-2-yl]carbamic acid (PubChem CID 121254944) has the molecular formula C33H46N3O7PS2 and a molecular weight of 691.85 g/mol. Its IUPAC name is [(2S)-1-[(2S,3aS,7aS)-2-[[(1R)-1-bis(4-methylsulfanylphenoxy)phosphorylbutyl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-methyl-1-oxobutan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[(2S,3aS,7aS)-2-[[(1R)-1-bis(4-methylsulfanylphenoxy)phosphorylbutyl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-methyl-1-oxobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 121254944 |
| Molecular Formula | C33H46N3O7PS2 |
| Molecular Weight | 691.85 g/mol |
| Exact Mass | 691.25 |
| IUPAC Name | [(2S)-1-[(2S,3aS,7aS)-2-[[(1R)-1-bis(4-methylsulfanylphenoxy)phosphorylbutyl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-methyl-1-oxobutan-2-yl]carbamic acid |
| SMILES | CCC[C@H](NC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1C(=O)[C@@H](NC(=O)O)C(C)C)P(=O)(Oc1ccc(SC)cc1)Oc1ccc(SC)cc1 |
| InChI | InChI=1S/C33H46N3O7PS2/c1-6-9-29(44(41,42-23-12-16-25(45-4)17-13-23)43-24-14-18-26(46-5)19-15-24)34-31(37)28-20-22-10-7-8-11-27(22)36(28)32(38)30(21(2)3)35-33(39)40/h12-19,21-22,27-30,35H,6-11,20H2,1-5H3,(H,34,37)(H,39,40)/t22-,27-,28-,29+,30-/m0/s1 |
| InChIKey | UJTUMABLUVXDDN-DDRBTIHYSA-N |
| XLogP | 7.48 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.85 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|