C23H31N3O5 — CID 89087574
(2S,3aS,7aS)-1-acetyl-N-[(3S)-1,2-dioxo-1-(phenoxyamino)hexan-3-yl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 89087574) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-acetyl-N-[(3S)-1,2-dioxo-1-(phenoxyamino)hexan-3-yl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (2S,3aS,7aS)-1-acetyl-N-[(3S)-1,2-dioxo-1-(phenoxyamino)hexan-3-yl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 89087574 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | (2S,3aS,7aS)-1-acetyl-N-[(3S)-1,2-dioxo-1-(phenoxyamino)hexan-3-yl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | CCC[C@H](NC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1C(C)=O)C(=O)C(=O)NOc1ccccc1 |
| InChI | InChI=1S/C23H31N3O5/c1-3-9-18(21(28)23(30)25-31-17-11-5-4-6-12-17)24-22(29)20-14-16-10-7-8-13-19(16)26(20)15(2)27/h4-6,11-12,16,18-20H,3,7-10,13-14H2,1-2H3,(H,24,29)(H,25,30)/t16-,18-,19-,20-/m0/s1 |
| InChIKey | XMONQTYCFNDQNU-LEAZDLGRSA-N |
| XLogP | 2.13 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|