C21H35N3O5 — CID 89087458
(2S,3aS,7aS)-1-acetyl-N-[(3S)-1-(2-methylpropoxyamino)-1,2-dioxohexan-3-yl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 89087458) has the molecular formula C21H35N3O5 and a molecular weight of 409.53 g/mol. Its IUPAC name is (2S,3aS,7aS)-1-acetyl-N-[(3S)-1-(2-methylpropoxyamino)-1,2-dioxohexan-3-yl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (2S,3aS,7aS)-1-acetyl-N-[(3S)-1-(2-methylpropoxyamino)-1,2-dioxohexan-3-yl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 89087458 |
| Molecular Formula | C21H35N3O5 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | (2S,3aS,7aS)-1-acetyl-N-[(3S)-1-(2-methylpropoxyamino)-1,2-dioxohexan-3-yl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | CCC[C@H](NC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1C(C)=O)C(=O)C(=O)NOCC(C)C |
| InChI | InChI=1S/C21H35N3O5/c1-5-8-16(19(26)21(28)23-29-12-13(2)3)22-20(27)18-11-15-9-6-7-10-17(15)24(18)14(4)25/h13,15-18H,5-12H2,1-4H3,(H,22,27)(H,23,28)/t15-,16-,17-,18-/m0/s1 |
| InChIKey | DAIAWZLFTQQQCK-XSLAGTTESA-N |
| XLogP | 1.72 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|