C19H34N2O3 — CID 58997735
ethyl (2S)-2-[[(2R)-1-[(2R)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]amino]pentanoate (PubChem CID 58997735) has the molecular formula C19H34N2O3 and a molecular weight of 338.49 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2R)-1-[(2R)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]amino]pentanoate.
| Compound Name | ethyl (2S)-2-[[(2R)-1-[(2R)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]amino]pentanoate |
|---|---|
| PubChem CID | 58997735 |
| Molecular Formula | C19H34N2O3 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | ethyl (2S)-2-[[(2R)-1-[(2R)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-1-oxopropan-2-yl]amino]pentanoate |
| SMILES | CCC[C@H](N[C@H](C)C(=O)N1C2CCCCC2C[C@H]1C)C(=O)OCC |
| InChI | InChI=1S/C19H34N2O3/c1-5-9-16(19(23)24-6-2)20-14(4)18(22)21-13(3)12-15-10-7-8-11-17(15)21/h13-17,20H,5-12H2,1-4H3/t13-,14-,15?,16+,17?/m1/s1 |
| InChIKey | MVVUTBGOKOEFRT-HLUWQOEYSA-N |
| XLogP | 2.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |