C26H40N2O4 — CID 142683021
benzyl (2S,3aS,7aS)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxopentan-2-yl]amino]propyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 142683021) has the molecular formula C26H40N2O4 and a molecular weight of 444.62 g/mol. Its IUPAC name is benzyl (2S,3aS,7aS)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxopentan-2-yl]amino]propyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | benzyl (2S,3aS,7aS)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxopentan-2-yl]amino]propyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 142683021 |
| Molecular Formula | C26H40N2O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | benzyl (2S,3aS,7aS)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxopentan-2-yl]amino]propyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | CCC[C@H](N[C@@H](C)CN1[C@H](C(=O)OCc2ccccc2)C[C@@H]2CCCC[C@@H]21)C(=O)OCC |
| InChI | InChI=1S/C26H40N2O4/c1-4-11-22(25(29)31-5-2)27-19(3)17-28-23-15-10-9-14-21(23)16-24(28)26(30)32-18-20-12-7-6-8-13-20/h6-8,12-13,19,21-24,27H,4-5,9-11,14-18H2,1-3H3/t19-,21-,22-,23-,24-/m0/s1 |
| InChIKey | SDEHQDAFFNIGBE-DUSBTPNUSA-N |
| XLogP | 4.07 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |