C22H28N2O6 — CID 23243315
methyl (2R)-2-[[(2S,3aS,6R,7aS)-1-acetyl-6-acetyloxy-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]-2-phenylacetate (PubChem CID 23243315) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is methyl (2R)-2-[[(2S,3aS,6R,7aS)-1-acetyl-6-acetyloxy-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]-2-phenylacetate.
| Compound Name | methyl (2R)-2-[[(2S,3aS,6R,7aS)-1-acetyl-6-acetyloxy-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 23243315 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | methyl (2R)-2-[[(2S,3aS,6R,7aS)-1-acetyl-6-acetyloxy-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]-2-phenylacetate |
| SMILES | COC(=O)[C@H](NC(=O)[C@@H]1C[C@@H]2CC[C@@H](OC(C)=O)C[C@@H]2N1C(C)=O)c1ccccc1 |
| InChI | InChI=1S/C22H28N2O6/c1-13(25)24-18-12-17(30-14(2)26)10-9-16(18)11-19(24)21(27)23-20(22(28)29-3)15-7-5-4-6-8-15/h4-8,16-20H,9-12H2,1-3H3,(H,23,27)/t16-,17+,18-,19-,20+/m0/s1 |
| InChIKey | UUUCFBBKSNBQIS-LJDSDSDDSA-N |
| XLogP | 1.74 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |