C26H31N3O6 — CID 175695357
2-[[(1S)-2-(4-methoxyanilino)-1-(4-methoxyphenyl)-2-oxoethyl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylic acid (PubChem CID 175695357) has the molecular formula C26H31N3O6 and a molecular weight of 481.55 g/mol. Its IUPAC name is 2-[[(1S)-2-(4-methoxyanilino)-1-(4-methoxyphenyl)-2-oxoethyl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylic acid.
| Compound Name | 2-[[(1S)-2-(4-methoxyanilino)-1-(4-methoxyphenyl)-2-oxoethyl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylic acid |
|---|---|
| PubChem CID | 175695357 |
| Molecular Formula | C26H31N3O6 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 2-[[(1S)-2-(4-methoxyanilino)-1-(4-methoxyphenyl)-2-oxoethyl]carbamoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylic acid |
| SMILES | COc1ccc(NC(=O)[C@@H](NC(=O)C2CC3CCCCC3N2C(=O)O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H31N3O6/c1-34-19-11-7-16(8-12-19)23(25(31)27-18-9-13-20(35-2)14-10-18)28-24(30)22-15-17-5-3-4-6-21(17)29(22)26(32)33/h7-14,17,21-23H,3-6,15H2,1-2H3,(H,27,31)(H,28,30)(H,32,33)/t17?,21?,22?,23-/m0/s1 |
| InChIKey | OVAWJVLJBRJQDQ-UASPFYKSSA-N |
| XLogP | 3.81 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |