C6H5F2NO3 — CID 121256126
2-[5-(difluoromethyl)-1,2-oxazol-3-yl]acetic acid (PubChem CID 121256126) has the molecular formula C6H5F2NO3 and a molecular weight of 177.11 g/mol. Its IUPAC name is 2-[5-(difluoromethyl)-1,2-oxazol-3-yl]acetic acid.
| Compound Name | 2-[5-(difluoromethyl)-1,2-oxazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 121256126 |
| Molecular Formula | C6H5F2NO3 |
| Molecular Weight | 177.11 g/mol |
| Exact Mass | 177.02 |
| IUPAC Name | 2-[5-(difluoromethyl)-1,2-oxazol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1cc(C(F)F)on1 |
| InChI | InChI=1S/C6H5F2NO3/c7-6(8)4-1-3(9-12-4)2-5(10)11/h1,6H,2H2,(H,10,11) |
| InChIKey | NQPOAGRIQYOWAT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.11 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |