C19H17F2N5O2S — CID 121257516
6-[3-(1,1-difluoroethyl)phenyl]-N-(4-methyl-1,3-thiazol-2-yl)-2,3-dihydropyrazino[2,3-b][1,4]oxazine-4-carboxamide (PubChem CID 121257516) has the molecular formula C19H17F2N5O2S and a molecular weight of 417.44 g/mol. Its IUPAC name is 6-[3-(1,1-difluoroethyl)phenyl]-N-(4-methyl-1,3-thiazol-2-yl)-2,3-dihydropyrazino[2,3-b][1,4]oxazine-4-carboxamide.
| Compound Name | 6-[3-(1,1-difluoroethyl)phenyl]-N-(4-methyl-1,3-thiazol-2-yl)-2,3-dihydropyrazino[2,3-b][1,4]oxazine-4-carboxamide |
|---|---|
| PubChem CID | 121257516 |
| Molecular Formula | C19H17F2N5O2S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 6-[3-(1,1-difluoroethyl)phenyl]-N-(4-methyl-1,3-thiazol-2-yl)-2,3-dihydropyrazino[2,3-b][1,4]oxazine-4-carboxamide |
| SMILES | Cc1csc(NC(=O)N2CCOc3ncc(-c4cccc(C(C)(F)F)c4)nc32)n1 |
| InChI | InChI=1S/C19H17F2N5O2S/c1-11-10-29-17(23-11)25-18(27)26-6-7-28-16-15(26)24-14(9-22-16)12-4-3-5-13(8-12)19(2,20)21/h3-5,8-10H,6-7H2,1-2H3,(H,23,25,27) |
| InChIKey | VGCPXMSTNFTHIE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |