C21H15Cl2N3O — CID 121264147
N-(3-cyanophenyl)-2-(3,4-dichloroanilino)-2-phenylacetamide (PubChem CID 121264147) has the molecular formula C21H15Cl2N3O and a molecular weight of 396.28 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-(3,4-dichloroanilino)-2-phenylacetamide.
| Compound Name | N-(3-cyanophenyl)-2-(3,4-dichloroanilino)-2-phenylacetamide |
|---|---|
| PubChem CID | 121264147 |
| Molecular Formula | C21H15Cl2N3O |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | N-(3-cyanophenyl)-2-(3,4-dichloroanilino)-2-phenylacetamide |
| SMILES | N#Cc1cccc(NC(=O)C(Nc2ccc(Cl)c(Cl)c2)c2ccccc2)c1 |
| InChI | InChI=1S/C21H15Cl2N3O/c22-18-10-9-17(12-19(18)23)25-20(15-6-2-1-3-7-15)21(27)26-16-8-4-5-14(11-16)13-24/h1-12,20,25H,(H,26,27) |
| InChIKey | ZJADNDDCJGDNTJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |