About 2-[1,3-di(propan-2-yloxy)propan-2-yloxy]-1-methoxy-4,4-dimethylpentan-2-ol
2-[1,3-di(propan-2-yloxy)propan-2-yloxy]-1-methoxy-4,4-dimethylpentan-2-ol (PubChem CID 121265086) has the molecular formula C17H36O5
and a molecular weight of 320.47 g/mol. Its IUPAC name is 2-[1,3-di(propan-2-yloxy)propan-2-yloxy]-1-methoxy-4,4-dimethylpentan-2-ol.
Molecular Properties
| Compound Name | 2-[1,3-di(propan-2-yloxy)propan-2-yloxy]-1-methoxy-4,4-dimethylpentan-2-ol |
| PubChem CID | 121265086 |
| Molecular Formula | C17H36O5 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | 2-[1,3-di(propan-2-yloxy)propan-2-yloxy]-1-methoxy-4,4-dimethylpentan-2-ol |
| SMILES | COCC(O)(CC(C)(C)C)OC(COC(C)C)COC(C)C |
| InChI | InChI=1S/C17H36O5/c1-13(2)20-9-15(10-21-14(3)4)22-17(18,12-19-8)11-16(5,6)7/h13-15,18H,9-12H2,1-8H3 |
| InChIKey | QKNISBSSVITIBH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[1,3-di(propan-2-yloxy)propan-2-yloxy]-1-methoxy-4,4-dimethylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,3-di(propan-2-yloxy)propan-2-yloxy]-1-methoxy-4,4-dimethylpentan-2-ol?
The IUPAC name of 2-[1,3-di(propan-2-yloxy)propan-2-yloxy]-1-methoxy-4,4-dimethylpentan-2-ol (CID 121265086) is 2-[1,3-di(propan-2-yloxy)propan-2-yloxy]-1-methoxy-4,4-dimethylpentan-2-ol.
What is the SMILES notation for 2-[1,3-di(propan-2-yloxy)propan-2-yloxy]-1-methoxy-4,4-dimethylpentan-2-ol?
The canonical SMILES for 2-[1,3-di(propan-2-yloxy)propan-2-yloxy]-1-methoxy-4,4-dimethylpentan-2-ol is COCC(O)(CC(C)(C)C)OC(COC(C)C)COC(C)C.
What is the InChIKey of 2-[1,3-di(propan-2-yloxy)propan-2-yloxy]-1-methoxy-4,4-dimethylpentan-2-ol?
The InChIKey is QKNISBSSVITIBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36O5/c1-13(2)20-9-15(10-21-14(3)4)22-17(18,12-19-8)11-16(5,6)7/h13-15,18H,9-12H2,1-8H3.
What are the key properties of 2-[1,3-di(propan-2-yloxy)propan-2-yloxy]-1-methoxy-4,4-dimethylpentan-2-ol?
2-[1,3-di(propan-2-yloxy)propan-2-yloxy]-1-methoxy-4,4-dimethylpentan-2-ol has a molecular weight of 320.47 g/mol, XLogP of 2.99, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,3-di(propan-2-yloxy)propan-2-yloxy]-1-methoxy-4,4-dimethylpentan-2-ol is sourced from PubChem (CID 121265086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).