C16H9F3O3 — CID 121271458
methyl 4-[2-(2,6-difluoro-4-hydroxyphenyl)ethynyl]-3-fluorobenzoate (PubChem CID 121271458) has the molecular formula C16H9F3O3 and a molecular weight of 306.24 g/mol. Its IUPAC name is methyl 4-[2-(2,6-difluoro-4-hydroxyphenyl)ethynyl]-3-fluorobenzoate.
| Compound Name | methyl 4-[2-(2,6-difluoro-4-hydroxyphenyl)ethynyl]-3-fluorobenzoate |
|---|---|
| PubChem CID | 121271458 |
| Molecular Formula | C16H9F3O3 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | methyl 4-[2-(2,6-difluoro-4-hydroxyphenyl)ethynyl]-3-fluorobenzoate |
| SMILES | COC(=O)c1ccc(C#Cc2c(F)cc(O)cc2F)c(F)c1 |
| InChI | InChI=1S/C16H9F3O3/c1-22-16(21)10-3-2-9(13(17)6-10)4-5-12-14(18)7-11(20)8-15(12)19/h2-3,6-8,20H,1H3 |
| InChIKey | ZSGPADDUQFHVBS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|