C15H14FNO2 — CID 166559010
methyl 4-(4-cyano-3,3-dimethylbut-1-ynyl)-3-fluorobenzoate (PubChem CID 166559010) has the molecular formula C15H14FNO2 and a molecular weight of 259.28 g/mol. Its IUPAC name is methyl 4-(4-cyano-3,3-dimethylbut-1-ynyl)-3-fluorobenzoate.
| Compound Name | methyl 4-(4-cyano-3,3-dimethylbut-1-ynyl)-3-fluorobenzoate |
|---|---|
| PubChem CID | 166559010 |
| Molecular Formula | C15H14FNO2 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | methyl 4-(4-cyano-3,3-dimethylbut-1-ynyl)-3-fluorobenzoate |
| SMILES | COC(=O)c1ccc(C#CC(C)(C)CC#N)c(F)c1 |
| InChI | InChI=1S/C15H14FNO2/c1-15(2,8-9-17)7-6-11-4-5-12(10-13(11)16)14(18)19-3/h4-5,10H,8H2,1-3H3 |
| InChIKey | DUMZVCHTOKBYBC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|