C19H17Cl2NO2 — CID 121272956
(1S)-2-[2-(2,6-dichlorophenyl)acetyl]-1-methyl-3,4-dihydro-1H-isoquinoline-5-carbaldehyde (PubChem CID 121272956) has the molecular formula C19H17Cl2NO2 and a molecular weight of 362.26 g/mol. Its IUPAC name is (1S)-2-[2-(2,6-dichlorophenyl)acetyl]-1-methyl-3,4-dihydro-1H-isoquinoline-5-carbaldehyde.
| Compound Name | (1S)-2-[2-(2,6-dichlorophenyl)acetyl]-1-methyl-3,4-dihydro-1H-isoquinoline-5-carbaldehyde |
|---|---|
| PubChem CID | 121272956 |
| Molecular Formula | C19H17Cl2NO2 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | (1S)-2-[2-(2,6-dichlorophenyl)acetyl]-1-methyl-3,4-dihydro-1H-isoquinoline-5-carbaldehyde |
| SMILES | C[C@H]1c2cccc(C=O)c2CCN1C(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H17Cl2NO2/c1-12-14-5-2-4-13(11-23)15(14)8-9-22(12)19(24)10-16-17(20)6-3-7-18(16)21/h2-7,11-12H,8-10H2,1H3/t12-/m0/s1 |
| InChIKey | ZGPVDSQEKCBAHW-LBPRGKRZSA-N |
| XLogP | 4.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|