C18H18Cl2N2O — CID 121272965
1-[(1S)-5-amino-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]-2-(2,6-dichlorophenyl)ethanone (PubChem CID 121272965) has the molecular formula C18H18Cl2N2O and a molecular weight of 349.26 g/mol. Its IUPAC name is 1-[(1S)-5-amino-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]-2-(2,6-dichlorophenyl)ethanone.
| Compound Name | 1-[(1S)-5-amino-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]-2-(2,6-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 121272965 |
| Molecular Formula | C18H18Cl2N2O |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 1-[(1S)-5-amino-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl]-2-(2,6-dichlorophenyl)ethanone |
| SMILES | C[C@H]1c2cccc(N)c2CCN1C(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H18Cl2N2O/c1-11-12-4-2-7-17(21)13(12)8-9-22(11)18(23)10-14-15(19)5-3-6-16(14)20/h2-7,11H,8-10,21H2,1H3/t11-/m0/s1 |
| InChIKey | YLMYMDDZTDMHJH-NSHDSACASA-N |
| XLogP | 4.26 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|