C17H16Cl2N2O — CID 121279466
1-(4-amino-1-methyl-1,3-dihydroisoindol-2-yl)-2-(2,6-dichlorophenyl)ethanone (PubChem CID 121279466) has the molecular formula C17H16Cl2N2O and a molecular weight of 335.23 g/mol. Its IUPAC name is 1-(4-amino-1-methyl-1,3-dihydroisoindol-2-yl)-2-(2,6-dichlorophenyl)ethanone.
| Compound Name | 1-(4-amino-1-methyl-1,3-dihydroisoindol-2-yl)-2-(2,6-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 121279466 |
| Molecular Formula | C17H16Cl2N2O |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 1-(4-amino-1-methyl-1,3-dihydroisoindol-2-yl)-2-(2,6-dichlorophenyl)ethanone |
| SMILES | CC1c2cccc(N)c2CN1C(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H16Cl2N2O/c1-10-11-4-2-7-16(20)13(11)9-21(10)17(22)8-12-14(18)5-3-6-15(12)19/h2-7,10H,8-9,20H2,1H3 |
| InChIKey | VHKNNGCGZBDBCB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|