C8H12F2N4O4 — CID 121273274
6-amino-3-[(2R,4S,5S)-5-[difluoro(hydroxy)methyl]-4-hydroxyoxolan-2-yl]-1,4-dihydro-1,3,5-triazin-2-one (PubChem CID 121273274) has the molecular formula C8H12F2N4O4 and a molecular weight of 266.20 g/mol. Its IUPAC name is 6-amino-3-[(2R,4S,5S)-5-[difluoro(hydroxy)methyl]-4-hydroxyoxolan-2-yl]-1,4-dihydro-1,3,5-triazin-2-one.
| Compound Name | 6-amino-3-[(2R,4S,5S)-5-[difluoro(hydroxy)methyl]-4-hydroxyoxolan-2-yl]-1,4-dihydro-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 121273274 |
| Molecular Formula | C8H12F2N4O4 |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 6-amino-3-[(2R,4S,5S)-5-[difluoro(hydroxy)methyl]-4-hydroxyoxolan-2-yl]-1,4-dihydro-1,3,5-triazin-2-one |
| SMILES | NC1=NCN([C@H]2C[C@H](O)[C@@H](C(O)(F)F)O2)C(=O)N1 |
| InChI | InChI=1S/C8H12F2N4O4/c9-8(10,17)5-3(15)1-4(18-5)14-2-12-6(11)13-7(14)16/h3-5,15,17H,1-2H2,(H3,11,12,13,16)/t3-,4+,5-/m0/s1 |
| InChIKey | ZQCZJBJVXUDPBN-LMVFSUKVSA-N |
| XLogP | -1.66 |
| TPSA | 120.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |