C24H26N4O5S — CID 11329159
[(2R,3S,5S)-5-(6-amino-2-oxo-1,4-dihydro-1,3,5-triazin-3-yl)-3-(4-methylbenzoyl)oxythiolan-2-yl]methyl 4-methylbenzoate (PubChem CID 11329159) has the molecular formula C24H26N4O5S and a molecular weight of 482.56 g/mol. Its IUPAC name is [(2R,3S,5S)-5-(6-amino-2-oxo-1,4-dihydro-1,3,5-triazin-3-yl)-3-(4-methylbenzoyl)oxythiolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2R,3S,5S)-5-(6-amino-2-oxo-1,4-dihydro-1,3,5-triazin-3-yl)-3-(4-methylbenzoyl)oxythiolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 11329159 |
| Molecular Formula | C24H26N4O5S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | [(2R,3S,5S)-5-(6-amino-2-oxo-1,4-dihydro-1,3,5-triazin-3-yl)-3-(4-methylbenzoyl)oxythiolan-2-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC[C@H]2S[C@H](N3CN=C(N)NC3=O)C[C@@H]2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H26N4O5S/c1-14-3-7-16(8-4-14)21(29)32-12-19-18(33-22(30)17-9-5-15(2)6-10-17)11-20(34-19)28-13-26-23(25)27-24(28)31/h3-10,18-20H,11-13H2,1-2H3,(H3,25,26,27,31)/t18-,19+,20-/m0/s1 |
| InChIKey | HFPGWEFIJJGLSQ-ZCNNSNEGSA-N |
| XLogP | 2.81 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |