C13H27I — CID 121274661
7-iodo-2,3,3,4,5-pentamethyloctane (PubChem CID 121274661) has the molecular formula C13H27I and a molecular weight of 310.26 g/mol. Its IUPAC name is 7-iodo-2,3,3,4,5-pentamethyloctane.
| Compound Name | 7-iodo-2,3,3,4,5-pentamethyloctane |
|---|---|
| PubChem CID | 121274661 |
| Molecular Formula | C13H27I |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 7-iodo-2,3,3,4,5-pentamethyloctane |
| SMILES | CC(I)CC(C)C(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C13H27I/c1-9(2)13(6,7)12(5)10(3)8-11(4)14/h9-12H,8H2,1-7H3 |
| InChIKey | QMUGZUZZALYYMD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|