About ethoxymethyl 4-[(4-aminocyclohexyl)oxymethoxy]cyclohexane-1-carboxylate
ethoxymethyl 4-[(4-aminocyclohexyl)oxymethoxy]cyclohexane-1-carboxylate (PubChem CID 121274834) has the molecular formula C17H31NO5
and a molecular weight of 329.44 g/mol. Its IUPAC name is ethoxymethyl 4-[(4-aminocyclohexyl)oxymethoxy]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethoxymethyl 4-[(4-aminocyclohexyl)oxymethoxy]cyclohexane-1-carboxylate |
| PubChem CID | 121274834 |
| Molecular Formula | C17H31NO5 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | ethoxymethyl 4-[(4-aminocyclohexyl)oxymethoxy]cyclohexane-1-carboxylate |
| SMILES | CCOCOC(=O)C1CCC(OCOC2CCC(N)CC2)CC1 |
| InChI | InChI=1S/C17H31NO5/c1-2-20-11-23-17(19)13-3-7-15(8-4-13)21-12-22-16-9-5-14(18)6-10-16/h13-16H,2-12,18H2,1H3 |
| InChIKey | WGXDPOQTVCQHAW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethoxymethyl 4-[(4-aminocyclohexyl)oxymethoxy]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxymethyl 4-[(4-aminocyclohexyl)oxymethoxy]cyclohexane-1-carboxylate?
The IUPAC name of ethoxymethyl 4-[(4-aminocyclohexyl)oxymethoxy]cyclohexane-1-carboxylate (CID 121274834) is ethoxymethyl 4-[(4-aminocyclohexyl)oxymethoxy]cyclohexane-1-carboxylate.
What is the SMILES notation for ethoxymethyl 4-[(4-aminocyclohexyl)oxymethoxy]cyclohexane-1-carboxylate?
The canonical SMILES for ethoxymethyl 4-[(4-aminocyclohexyl)oxymethoxy]cyclohexane-1-carboxylate is CCOCOC(=O)C1CCC(OCOC2CCC(N)CC2)CC1.
What is the InChIKey of ethoxymethyl 4-[(4-aminocyclohexyl)oxymethoxy]cyclohexane-1-carboxylate?
The InChIKey is WGXDPOQTVCQHAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31NO5/c1-2-20-11-23-17(19)13-3-7-15(8-4-13)21-12-22-16-9-5-14(18)6-10-16/h13-16H,2-12,18H2,1H3.
What are the key properties of ethoxymethyl 4-[(4-aminocyclohexyl)oxymethoxy]cyclohexane-1-carboxylate?
ethoxymethyl 4-[(4-aminocyclohexyl)oxymethoxy]cyclohexane-1-carboxylate has a molecular weight of 329.44 g/mol, XLogP of 2.34, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxymethyl 4-[(4-aminocyclohexyl)oxymethoxy]cyclohexane-1-carboxylate is sourced from PubChem (CID 121274834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).