C22H40O3 — CID 121279237
(Z)-5-[(1S,2R,3S,4R)-2,3-bis(butoxymethyl)-4-ethenylcyclopentyl]pent-4-en-1-ol (PubChem CID 121279237) has the molecular formula C22H40O3 and a molecular weight of 352.56 g/mol. Its IUPAC name is (Z)-5-[(1S,2R,3S,4R)-2,3-bis(butoxymethyl)-4-ethenylcyclopentyl]pent-4-en-1-ol.
| Compound Name | (Z)-5-[(1S,2R,3S,4R)-2,3-bis(butoxymethyl)-4-ethenylcyclopentyl]pent-4-en-1-ol |
|---|---|
| PubChem CID | 121279237 |
| Molecular Formula | C22H40O3 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | (Z)-5-[(1S,2R,3S,4R)-2,3-bis(butoxymethyl)-4-ethenylcyclopentyl]pent-4-en-1-ol |
| SMILES | C=C[C@H]1C[C@@H](/C=C\CCCO)[C@@H](COCCCC)[C@H]1COCCCC |
| InChI | InChI=1S/C22H40O3/c1-4-7-14-24-17-21-19(6-3)16-20(12-10-9-11-13-23)22(21)18-25-15-8-5-2/h6,10,12,19-23H,3-5,7-9,11,13-18H2,1-2H3/b12-10-/t19-,20+,21-,22+/m0/s1 |
| InChIKey | XRBASIZLNRFOFC-CDSNTXCWSA-N |
| XLogP | 5.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|