C18H30O12S6 — CID 121284693
(2S,3R)-2,3-diacetyloxy-4-[2-[[(2R,3S)-2,3-diacetyloxy-4-sulfinobutyl]disulfanyl]ethyldisulfanyl]butane-1-sulfinic acid (PubChem CID 121284693) has the molecular formula C18H30O12S6 and a molecular weight of 630.83 g/mol. Its IUPAC name is (2S,3R)-2,3-diacetyloxy-4-[2-[[(2R,3S)-2,3-diacetyloxy-4-sulfinobutyl]disulfanyl]ethyldisulfanyl]butane-1-sulfinic acid.
| Compound Name | (2S,3R)-2,3-diacetyloxy-4-[2-[[(2R,3S)-2,3-diacetyloxy-4-sulfinobutyl]disulfanyl]ethyldisulfanyl]butane-1-sulfinic acid |
|---|---|
| PubChem CID | 121284693 |
| Molecular Formula | C18H30O12S6 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.01 |
| IUPAC Name | (2S,3R)-2,3-diacetyloxy-4-[2-[[(2R,3S)-2,3-diacetyloxy-4-sulfinobutyl]disulfanyl]ethyldisulfanyl]butane-1-sulfinic acid |
| SMILES | CC(=O)O[C@@H](CSSCCSSC[C@H](OC(C)=O)[C@@H](CS(=O)O)OC(C)=O)[C@@H](CS(=O)O)OC(C)=O |
| InChI | InChI=1S/C18H30O12S6/c1-11(19)27-15(17(9-35(23)24)29-13(3)21)7-33-31-5-6-32-34-8-16(28-12(2)20)18(10-36(25)26)30-14(4)22/h15-18H,5-10H2,1-4H3,(H,23,24)(H,25,26)/t15-,16-,17+,18+/m0/s1 |
| InChIKey | RFLOITIFHVVPBL-WNRNVDISSA-N |
| XLogP | 1.92 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|