C19H14F2N2O3 — CID 121285164
4-[2-[2-(1,1-difluoroethoxy)phenyl]pyrimidin-4-yl]benzoic acid (PubChem CID 121285164) has the molecular formula C19H14F2N2O3 and a molecular weight of 356.33 g/mol. Its IUPAC name is 4-[2-[2-(1,1-difluoroethoxy)phenyl]pyrimidin-4-yl]benzoic acid.
| Compound Name | 4-[2-[2-(1,1-difluoroethoxy)phenyl]pyrimidin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 121285164 |
| Molecular Formula | C19H14F2N2O3 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 4-[2-[2-(1,1-difluoroethoxy)phenyl]pyrimidin-4-yl]benzoic acid |
| SMILES | CC(F)(F)Oc1ccccc1-c1nccc(-c2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C19H14F2N2O3/c1-19(20,21)26-16-5-3-2-4-14(16)17-22-11-10-15(23-17)12-6-8-13(9-7-12)18(24)25/h2-11H,1H3,(H,24,25) |
| InChIKey | UYOHMSJQXWOBCD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |