C16H15ClF5N3O3S — CID 121294880
N-(3-chloro-4,5-difluorophenyl)-1,5-dimethyl-4-[[(2R)-1,1,1-trifluoropropan-2-yl]sulfamoyl]pyrrole-2-carboxamide (PubChem CID 121294880) has the molecular formula C16H15ClF5N3O3S and a molecular weight of 459.82 g/mol. Its IUPAC name is N-(3-chloro-4,5-difluorophenyl)-1,5-dimethyl-4-[[(2R)-1,1,1-trifluoropropan-2-yl]sulfamoyl]pyrrole-2-carboxamide.
| Compound Name | N-(3-chloro-4,5-difluorophenyl)-1,5-dimethyl-4-[[(2R)-1,1,1-trifluoropropan-2-yl]sulfamoyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 121294880 |
| Molecular Formula | C16H15ClF5N3O3S |
| Molecular Weight | 459.82 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | N-(3-chloro-4,5-difluorophenyl)-1,5-dimethyl-4-[[(2R)-1,1,1-trifluoropropan-2-yl]sulfamoyl]pyrrole-2-carboxamide |
| SMILES | Cc1c(S(=O)(=O)N[C@H](C)C(F)(F)F)cc(C(=O)Nc2cc(F)c(F)c(Cl)c2)n1C |
| InChI | InChI=1S/C16H15ClF5N3O3S/c1-7-13(29(27,28)24-8(2)16(20,21)22)6-12(25(7)3)15(26)23-9-4-10(17)14(19)11(18)5-9/h4-6,8,24H,1-3H3,(H,23,26)/t8-/m1/s1 |
| InChIKey | WJQNMYJUKOFCJI-MRVPVSSYSA-N |
| XLogP | 3.75 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.82 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|